C13H12ClN5O2S — CID 118594610
4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-methylsulfinyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594610) has the molecular formula C13H12ClN5O2S and a molecular weight of 337.79 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-methylsulfinyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-methylsulfinyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594610 |
| Molecular Formula | C13H12ClN5O2S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-methylsulfinyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cn(Cc2ccc(Cl)nc2)c2nc(S(C)=O)nn2c1=O |
| InChI | InChI=1S/C13H12ClN5O2S/c1-8-6-18(7-9-3-4-10(14)15-5-9)13-16-12(22(2)21)17-19(13)11(8)20/h3-6H,7H2,1-2H3 |
| InChIKey | HTGGQYBLGDQIAC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|