C18H11F10NS — CID 118595875
10-ethyl-3,7-bis(1,1,2,2,2-pentafluoroethyl)phenothiazine (PubChem CID 118595875) has the molecular formula C18H11F10NS and a molecular weight of 463.34 g/mol. Its IUPAC name is 10-ethyl-3,7-bis(1,1,2,2,2-pentafluoroethyl)phenothiazine.
| Compound Name | 10-ethyl-3,7-bis(1,1,2,2,2-pentafluoroethyl)phenothiazine |
|---|---|
| PubChem CID | 118595875 |
| Molecular Formula | C18H11F10NS |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 10-ethyl-3,7-bis(1,1,2,2,2-pentafluoroethyl)phenothiazine |
| SMILES | CCN1c2ccc(C(F)(F)C(F)(F)F)cc2Sc2cc(C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H11F10NS/c1-2-29-11-5-3-9(15(19,20)17(23,24)25)7-13(11)30-14-8-10(4-6-12(14)29)16(21,22)18(26,27)28/h3-8H,2H2,1H3 |
| InChIKey | KTVXGXMAIIJBFW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|