C16H17F3N4O3S — CID 118595971
(NZ)-N-[(5E)-2-(3-ethylsulfonyl-2-pyridinyl)-3-methyl-5-[(E)-2-(trifluoromethyl)but-2-enylidene]imidazol-4-ylidene]hydroxylamine (PubChem CID 118595971) has the molecular formula C16H17F3N4O3S and a molecular weight of 402.40 g/mol. Its IUPAC name is (NZ)-N-[(5E)-2-(3-ethylsulfonyl-2-pyridinyl)-3-methyl-5-[(E)-2-(trifluoromethyl)but-2-enylidene]imidazol-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(5E)-2-(3-ethylsulfonyl-2-pyridinyl)-3-methyl-5-[(E)-2-(trifluoromethyl)but-2-enylidene]imidazol-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 118595971 |
| Molecular Formula | C16H17F3N4O3S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (NZ)-N-[(5E)-2-(3-ethylsulfonyl-2-pyridinyl)-3-methyl-5-[(E)-2-(trifluoromethyl)but-2-enylidene]imidazol-4-ylidene]hydroxylamine |
| SMILES | C/C=C(\C=C1\N=C(c2ncccc2S(=O)(=O)CC)N(C)\C1=N/O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O3S/c1-4-10(16(17,18)19)9-11-14(22-24)23(3)15(21-11)13-12(7-6-8-20-13)27(25,26)5-2/h4,6-9,24H,5H2,1-3H3/b10-4+,11-9+,22-14- |
| InChIKey | CJOLXCHMGAIMIA-OBGYNZJZSA-N |
| XLogP | 2.75 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|