C10H17N2O2+ — CID 118596292
2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl propanoate (PubChem CID 118596292) has the molecular formula C10H17N2O2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl propanoate.
| Compound Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl propanoate |
|---|---|
| PubChem CID | 118596292 |
| Molecular Formula | C10H17N2O2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-5-yl propanoate |
| SMILES | CCC(=O)O[N+]12CCCN=C1CCC2 |
| InChI | InChI=1S/C10H17N2O2/c1-2-10(13)14-12-7-3-5-9(12)11-6-4-8-12/h2-8H2,1H3/q+1 |
| InChIKey | SSZIIJWQSNDKHF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|