C8H17NO3 — CID 118596301
(3R,5R)-2,5-dimethyl-4-(methylamino)oxane-3,5-diol (PubChem CID 118596301) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (3R,5R)-2,5-dimethyl-4-(methylamino)oxane-3,5-diol.
| Compound Name | (3R,5R)-2,5-dimethyl-4-(methylamino)oxane-3,5-diol |
|---|---|
| PubChem CID | 118596301 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3R,5R)-2,5-dimethyl-4-(methylamino)oxane-3,5-diol |
| SMILES | CNC1[C@@H](O)C(C)OC[C@]1(C)O |
| InChI | InChI=1S/C8H17NO3/c1-5-6(10)7(9-3)8(2,11)4-12-5/h5-7,9-11H,4H2,1-3H3/t5?,6-,7?,8-/m0/s1 |
| InChIKey | DLRZVVAVDMQPGH-CDGKJWJHSA-N |
| XLogP | -0.89 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |