C12H20O4S — CID 118596442
5-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid (PubChem CID 118596442) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 118596442 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
| SMILES | CC1(C)O[C@H]2[C@H](CS[C@H]2CCCCC(=O)O)O1 |
| InChI | InChI=1S/C12H20O4S/c1-12(2)15-8-7-17-9(11(8)16-12)5-3-4-6-10(13)14/h8-9,11H,3-7H2,1-2H3,(H,13,14)/t8-,9-,11-/m0/s1 |
| InChIKey | TUVKFHXDXCELIE-QXEWZRGKSA-N |
| XLogP | 2.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|