C17H30NO2+ — CID 11859699
[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-piperidin-1-ium-1-ylacetate (PubChem CID 11859699) has the molecular formula C17H30NO2+ and a molecular weight of 280.43 g/mol. Its IUPAC name is [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-piperidin-1-ium-1-ylacetate.
| Compound Name | [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-piperidin-1-ium-1-ylacetate |
|---|---|
| PubChem CID | 11859699 |
| Molecular Formula | C17H30NO2+ |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-piperidin-1-ium-1-ylacetate |
| SMILES | CC1=C[C@@H](C)[C@H](COC(=O)C[NH+]2CCCCC2)[C@@H](C)C1 |
| InChI | InChI=1S/C17H29NO2/c1-13-9-14(2)16(15(3)10-13)12-20-17(19)11-18-7-5-4-6-8-18/h9,14-16H,4-8,10-12H2,1-3H3/p+1/t14-,15+,16+/m1/s1 |
| InChIKey | UUJZAPVGHSXVSM-PMPSAXMXSA-O |
| XLogP | 1.84 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|