C22H22ClN3O3 — CID 118597279
piperidin-1-yl N-[(7-chloro-4-oxo-1H-quinolin-3-yl)-phenylmethyl]carbamate (PubChem CID 118597279) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is piperidin-1-yl N-[(7-chloro-4-oxo-1H-quinolin-3-yl)-phenylmethyl]carbamate.
| Compound Name | piperidin-1-yl N-[(7-chloro-4-oxo-1H-quinolin-3-yl)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 118597279 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | piperidin-1-yl N-[(7-chloro-4-oxo-1H-quinolin-3-yl)-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)c1c[nH]c2cc(Cl)ccc2c1=O)ON1CCCCC1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-16-9-10-17-19(13-16)24-14-18(21(17)27)20(15-7-3-1-4-8-15)25-22(28)29-26-11-5-2-6-12-26/h1,3-4,7-10,13-14,20H,2,5-6,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | SXKOMNRHCXKEGE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |