C25H24N2O4 — CID 118597337
benzyl (2S)-2-[N-(azet-2-yl)anilino]-3-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)propanoate (PubChem CID 118597337) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is benzyl (2S)-2-[N-(azet-2-yl)anilino]-3-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)propanoate.
| Compound Name | benzyl (2S)-2-[N-(azet-2-yl)anilino]-3-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 118597337 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | benzyl (2S)-2-[N-(azet-2-yl)anilino]-3-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)propanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](CC1=CCC(O)(O)C=C1)N(C1=NC=C1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O4/c28-24(31-18-20-7-3-1-4-8-20)22(17-19-11-14-25(29,30)15-12-19)27(23-13-16-26-23)21-9-5-2-6-10-21/h1-14,16,22,29-30H,15,17-18H2/t22-/m0/s1 |
| InChIKey | IRLFCBMCBMXBMN-QFIPXVFZSA-N |
| XLogP | 3.49 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|