C7H12N2O3S — CID 118597373
N-[(3S,4R)-4-amino-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 118597373) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is N-[(3S,4R)-4-amino-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-amino-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118597373 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-[(3S,4R)-4-amino-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CS(=O)(=O)C[C@@H]1N |
| InChI | InChI=1S/C7H12N2O3S/c1-2-7(10)9-6-4-13(11,12)3-5(6)8/h2,5-6H,1,3-4,8H2,(H,9,10)/t5-,6+/m0/s1 |
| InChIKey | YPPGJCFGKYAJCT-NTSWFWBYSA-N |
| XLogP | -1.59 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|