C19H15FN4 — CID 118598457
3-[[5-(2-fluoro-3-phenylphenyl)pyrazin-2-yl]amino]propanenitrile (PubChem CID 118598457) has the molecular formula C19H15FN4 and a molecular weight of 318.36 g/mol. Its IUPAC name is 3-[[5-(2-fluoro-3-phenylphenyl)pyrazin-2-yl]amino]propanenitrile.
| Compound Name | 3-[[5-(2-fluoro-3-phenylphenyl)pyrazin-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 118598457 |
| Molecular Formula | C19H15FN4 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-[[5-(2-fluoro-3-phenylphenyl)pyrazin-2-yl]amino]propanenitrile |
| SMILES | N#CCCNc1cnc(-c2cccc(-c3ccccc3)c2F)cn1 |
| InChI | InChI=1S/C19H15FN4/c20-19-15(14-6-2-1-3-7-14)8-4-9-16(19)17-12-24-18(13-23-17)22-11-5-10-21/h1-4,6-9,12-13H,5,11H2,(H,22,24) |
| InChIKey | YAJIPCQFHJXDLB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|