C14H15F4N3O — CID 118599241
5-(4-fluoro-2-methylbut-3-yn-2-yl)-2-(3,3,3-trifluoropropylamino)pyridine-3-carboxamide (PubChem CID 118599241) has the molecular formula C14H15F4N3O and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-(4-fluoro-2-methylbut-3-yn-2-yl)-2-(3,3,3-trifluoropropylamino)pyridine-3-carboxamide.
| Compound Name | 5-(4-fluoro-2-methylbut-3-yn-2-yl)-2-(3,3,3-trifluoropropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118599241 |
| Molecular Formula | C14H15F4N3O |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-(4-fluoro-2-methylbut-3-yn-2-yl)-2-(3,3,3-trifluoropropylamino)pyridine-3-carboxamide |
| SMILES | CC(C)(C#CF)c1cnc(NCCC(F)(F)F)c(C(N)=O)c1 |
| InChI | InChI=1S/C14H15F4N3O/c1-13(2,3-5-15)9-7-10(11(19)22)12(21-8-9)20-6-4-14(16,17)18/h7-8H,4,6H2,1-2H3,(H2,19,22)(H,20,21) |
| InChIKey | NBJILVKUOYJSON-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|