5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid

C11H12F3NO2S — CID 118599282

IUPAC5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid
SMILESCSc1ccc(NCCC(F)(F)F)c(C(=O)O)c1
InChIInChI=1S/C11H12F3NO2S/c1-18-7-2-3-9(8(6-7)10(16)17)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17)
InChIKeyNAPJVPBDXWEMSZ-UHFFFAOYSA-N
MW279.28 g/mol
LogP3.47
Rot. Bonds5

About 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid

5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid (PubChem CID 118599282) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid.

Molecular Properties

Compound Name5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid
PubChem CID118599282
Molecular FormulaC11H12F3NO2S
Molecular Weight279.28 g/mol
Exact Mass279.05
IUPAC Name5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid
SMILESCSc1ccc(NCCC(F)(F)F)c(C(=O)O)c1
InChIInChI=1S/C11H12F3NO2S/c1-18-7-2-3-9(8(6-7)10(16)17)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17)
InChIKeyNAPJVPBDXWEMSZ-UHFFFAOYSA-N
XLogP3.47
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.28
LogP ≤ 53.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The IUPAC name of 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid (CID 118599282) is 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid.
What is the SMILES notation for 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The canonical SMILES for 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid is CSc1ccc(NCCC(F)(F)F)c(C(=O)O)c1.
What is the InChIKey of 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The InChIKey is NAPJVPBDXWEMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO2S/c1-18-7-2-3-9(8(6-7)10(16)17)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17).
What are the key properties of 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid has a molecular weight of 279.28 g/mol, XLogP of 3.47, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid is sourced from PubChem (CID 118599282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).