C21H28N2O4 — CID 118599453
5-(cyclopentylmethyl)-1,5-dimethyl-3-[(2-phenyl-1,3-dioxolan-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 118599453) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-1,5-dimethyl-3-[(2-phenyl-1,3-dioxolan-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(cyclopentylmethyl)-1,5-dimethyl-3-[(2-phenyl-1,3-dioxolan-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118599453 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 5-(cyclopentylmethyl)-1,5-dimethyl-3-[(2-phenyl-1,3-dioxolan-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC2(c3ccccc3)OCCO2)C(=O)C1(C)CC1CCCC1 |
| InChI | InChI=1S/C21H28N2O4/c1-20(14-16-8-6-7-9-16)18(24)23(19(25)22(20)2)15-21(26-12-13-27-21)17-10-4-3-5-11-17/h3-5,10-11,16H,6-9,12-15H2,1-2H3 |
| InChIKey | KOVINRXDSGKIDW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|