C31H25Cl2NO4S — CID 118599505
1-[4-[4-[4-chloro-2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]sulfanylphenyl]phenyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 118599505) has the molecular formula C31H25Cl2NO4S and a molecular weight of 578.52 g/mol. Its IUPAC name is 1-[4-[4-[4-chloro-2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]sulfanylphenyl]phenyl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[4-[4-chloro-2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]sulfanylphenyl]phenyl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 118599505 |
| Molecular Formula | C31H25Cl2NO4S |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 1-[4-[4-[4-chloro-2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]sulfanylphenyl]phenyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | C[C@@H](OC(=O)NSc1cc(Cl)ccc1-c1ccc(-c2ccc(C3(C(=O)O)CC3)cc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C31H25Cl2NO4S/c1-19(25-4-2-3-5-27(25)33)38-30(37)34-39-28-18-24(32)14-15-26(28)22-8-6-20(7-9-22)21-10-12-23(13-11-21)31(16-17-31)29(35)36/h2-15,18-19H,16-17H2,1H3,(H,34,37)(H,35,36)/t19-/m1/s1 |
| InChIKey | QPMIVJRXNOYHQN-LJQANCHMSA-N |
| XLogP | 8.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|