C60H66N15O16P — CID 118599725
tris[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-morpholin-4-ylphenyl)purin-9-yl]oxolan-2-yl]methyl] phosphate (PubChem CID 118599725) has the molecular formula C60H66N15O16P and a molecular weight of 1284.25 g/mol. Its IUPAC name is tris[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-morpholin-4-ylphenyl)purin-9-yl]oxolan-2-yl]methyl] phosphate.
| Compound Name | tris[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-morpholin-4-ylphenyl)purin-9-yl]oxolan-2-yl]methyl] phosphate |
|---|---|
| PubChem CID | 118599725 |
| Molecular Formula | C60H66N15O16P |
| Molecular Weight | 1284.25 g/mol |
| Exact Mass | 1283.45 |
| IUPAC Name | tris[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-morpholin-4-ylphenyl)purin-9-yl]oxolan-2-yl]methyl] phosphate |
| SMILES | O=P(OC[C@H]1O[C@@H](n2cnc3c(-c4cccc(N5CCOCC5)c4)ncnc32)[C@H](O)[C@@H]1O)(OC[C@H]1O[C@@H](n2cnc3c(-c4cccc(N5CCOCC5)c4)ncnc32)[C@H](O)[C@@H]1O)OC[C@H]1O[C@@H](n2cnc3c(-c4cccc(N5CCOCC5)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C60H66N15O16P/c76-49-40(89-58(52(49)79)73-31-67-46-43(61-28-64-55(46)73)34-4-1-7-37(22-34)70-10-16-83-17-11-70)25-86-92(82,87-26-41-50(77)53(80)59(90-41)74-32-68-47-44(62-29-65-56(47)74)35-5-2-8-38(23-35)71-12-18-84-19-13-71)88-27-42-51(78)54(81)60(91-42)75-33-69-48-45(63-30-66-57(48)75)36-6-3-9-39(24-36)72-14-20-85-21-15-72/h1-9,22-24,28-33,40-42,49-54,58-60,76-81H,10-21,25-27H2/t40-,41-,42-,49-,50-,51-,52-,53-,54-,58-,59-,60-/m1/s1 |
| InChIKey | WCYXXGKCDAQJPR-JHFFMPMESA-N |
| XLogP | 2.03 |
| TPSA | 362.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 31 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1284.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 31 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|