C54H48Cl3N12O13P — CID 118599734
tris[[(2R,3S,4R,5R)-5-[6-[(E)-2-(3-chlorophenyl)ethenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl] phosphate (PubChem CID 118599734) has the molecular formula C54H48Cl3N12O13P and a molecular weight of 1210.38 g/mol. Its IUPAC name is tris[[(2R,3S,4R,5R)-5-[6-[(E)-2-(3-chlorophenyl)ethenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl] phosphate.
| Compound Name | tris[[(2R,3S,4R,5R)-5-[6-[(E)-2-(3-chlorophenyl)ethenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
|---|---|
| PubChem CID | 118599734 |
| Molecular Formula | C54H48Cl3N12O13P |
| Molecular Weight | 1210.38 g/mol |
| Exact Mass | 1208.23 |
| IUPAC Name | tris[[(2R,3S,4R,5R)-5-[6-[(E)-2-(3-chlorophenyl)ethenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
| SMILES | O=P(OC[C@H]1O[C@@H](n2cnc3c(/C=C/c4cccc(Cl)c4)ncnc32)[C@H](O)[C@@H]1O)(OC[C@H]1O[C@@H](n2cnc3c(/C=C/c4cccc(Cl)c4)ncnc32)[C@H](O)[C@@H]1O)OC[C@H]1O[C@@H](n2cnc3c(/C=C/c4cccc(Cl)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C54H48Cl3N12O13P/c55-31-7-1-4-28(16-31)10-13-34-40-49(61-22-58-34)67(25-64-40)52-46(73)43(70)37(80-52)19-77-83(76,78-20-38-44(71)47(74)53(81-38)68-26-65-41-35(59-23-62-50(41)68)14-11-29-5-2-8-32(56)17-29)79-21-39-45(72)48(75)54(82-39)69-27-66-42-36(60-24-63-51(42)69)15-12-30-6-3-9-33(57)18-30/h1-18,22-27,37-39,43-48,52-54,70-75H,19-21H2/b13-10+,14-11+,15-12+/t37-,38-,39-,43-,44-,45-,46-,47-,48-,52-,53-,54-/m1/s1 |
| InChIKey | NVHKIERNCVKVRD-XBPGVYNESA-N |
| XLogP | 5.99 |
| TPSA | 324.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 83 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|