About 9-ethyl-6-methoxypurine
9-ethyl-6-methoxypurine (PubChem CID 118600108) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 9-ethyl-6-methoxypurine.
Molecular Properties
| Compound Name | 9-ethyl-6-methoxypurine |
| PubChem CID | 118600108 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 9-ethyl-6-methoxypurine |
| SMILES | CCn1cnc2c(OC)ncnc21 |
| InChI | InChI=1S/C8H10N4O/c1-3-12-5-11-6-7(12)9-4-10-8(6)13-2/h4-5H,3H2,1-2H3 |
| InChIKey | CXNOMPAZFVMAFL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-ethyl-6-methoxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-6-methoxypurine?
The IUPAC name of 9-ethyl-6-methoxypurine (CID 118600108) is 9-ethyl-6-methoxypurine.
What is the SMILES notation for 9-ethyl-6-methoxypurine?
The canonical SMILES for 9-ethyl-6-methoxypurine is CCn1cnc2c(OC)ncnc21.
What is the InChIKey of 9-ethyl-6-methoxypurine?
The InChIKey is CXNOMPAZFVMAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-3-12-5-11-6-7(12)9-4-10-8(6)13-2/h4-5H,3H2,1-2H3.
What are the key properties of 9-ethyl-6-methoxypurine?
9-ethyl-6-methoxypurine has a molecular weight of 178.19 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-6-methoxypurine is sourced from PubChem (CID 118600108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).