About (4R)-4-methoxy-2,2-dimethyloxolane
(4R)-4-methoxy-2,2-dimethyloxolane (PubChem CID 118600677) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (4R)-4-methoxy-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | (4R)-4-methoxy-2,2-dimethyloxolane |
| PubChem CID | 118600677 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (4R)-4-methoxy-2,2-dimethyloxolane |
| SMILES | CO[C@H]1COC(C)(C)C1 |
| InChI | InChI=1S/C7H14O2/c1-7(2)4-6(8-3)5-9-7/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | UPBIZPDHIDGZOR-ZCFIWIBFSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-methoxy-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methoxy-2,2-dimethyloxolane?
The IUPAC name of (4R)-4-methoxy-2,2-dimethyloxolane (CID 118600677) is (4R)-4-methoxy-2,2-dimethyloxolane.
What is the SMILES notation for (4R)-4-methoxy-2,2-dimethyloxolane?
The canonical SMILES for (4R)-4-methoxy-2,2-dimethyloxolane is CO[C@H]1COC(C)(C)C1.
What is the InChIKey of (4R)-4-methoxy-2,2-dimethyloxolane?
The InChIKey is UPBIZPDHIDGZOR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14O2/c1-7(2)4-6(8-3)5-9-7/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of (4R)-4-methoxy-2,2-dimethyloxolane?
(4R)-4-methoxy-2,2-dimethyloxolane has a molecular weight of 130.19 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methoxy-2,2-dimethyloxolane is sourced from PubChem (CID 118600677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).