About (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one
(7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one (PubChem CID 118600706) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one.
Molecular Properties
| Compound Name | (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one |
| PubChem CID | 118600706 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one |
| SMILES | CC(C)(C)/C=C1\C2CCOC(=O)N12 |
| InChI | InChI=1S/C10H15NO2/c1-10(2,3)6-8-7-4-5-13-9(12)11(7)8/h6-7H,4-5H2,1-3H3/b8-6+ |
| InChIKey | BBOGRMBVVNHIAG-SOFGYWHQSA-N |
| XLogP | 2.14 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one?
The IUPAC name of (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one (CID 118600706) is (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one.
What is the SMILES notation for (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one?
The canonical SMILES for (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one is CC(C)(C)/C=C1\C2CCOC(=O)N12.
What is the InChIKey of (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one?
The InChIKey is BBOGRMBVVNHIAG-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10(2,3)6-8-7-4-5-13-9(12)11(7)8/h6-7H,4-5H2,1-3H3/b8-6+.
What are the key properties of (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one?
(7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one has a molecular weight of 181.23 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-7-(2,2-dimethylpropylidene)-3-oxa-1-azabicyclo[4.1.0]heptan-2-one is sourced from PubChem (CID 118600706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).