About tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate
tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate (PubChem CID 118600845) has the molecular formula C18H31N3O3
and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate |
| PubChem CID | 118600845 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate |
| SMILES | CC(C)C[C@@H](/C=C/CC(=O)N1CCCC1)/N=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-14(2)13-15(19-20-17(23)24-18(3,4)5)9-8-10-16(22)21-11-6-7-12-21/h8-9,14-15H,6-7,10-13H2,1-5H3/b9-8+,20-19+/t15-/m1/s1 |
| InChIKey | YQQUHEDREHRVPN-BFNVEKFHSA-N |
| XLogP | 4.36 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate?
The IUPAC name of tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate (CID 118600845) is tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate.
What is the SMILES notation for tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate?
The canonical SMILES for tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate is CC(C)C[C@@H](/C=C/CC(=O)N1CCCC1)/N=N/C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate?
The InChIKey is YQQUHEDREHRVPN-BFNVEKFHSA-N. The full InChI is InChI=1S/C18H31N3O3/c1-14(2)13-15(19-20-17(23)24-18(3,4)5)9-8-10-16(22)21-11-6-7-12-21/h8-9,14-15H,6-7,10-13H2,1-5H3/b9-8+,20-19+/t15-/m1/s1.
What are the key properties of tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate?
tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate has a molecular weight of 337.46 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-pyrrolidin-1-yloct-5-en-4-yl]iminocarbamate is sourced from PubChem (CID 118600845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).