C9H13NO2 — CID 118600849
(2E,4Z)-6-methanimidoyl-2-methoxyhepta-2,4,6-trien-1-ol (PubChem CID 118600849) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (2E,4Z)-6-methanimidoyl-2-methoxyhepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4Z)-6-methanimidoyl-2-methoxyhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 118600849 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (2E,4Z)-6-methanimidoyl-2-methoxyhepta-2,4,6-trien-1-ol |
| SMILES | [H]/N=C/C(=C)/C=C\C=C(/CO)OC |
| InChI | InChI=1S/C9H13NO2/c1-8(6-10)4-3-5-9(7-11)12-2/h3-6,10-11H,1,7H2,2H3/b4-3-,9-5+,10-6+ |
| InChIKey | BSASMVRHMWRLRV-YFZPFDGNSA-N |
| XLogP | 1.27 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|