C26H40O3 — CID 118601136
benzyl 8-hydroxy-8-prop-2-enylcyclopentadecane-1-carboxylate (PubChem CID 118601136) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is benzyl 8-hydroxy-8-prop-2-enylcyclopentadecane-1-carboxylate.
| Compound Name | benzyl 8-hydroxy-8-prop-2-enylcyclopentadecane-1-carboxylate |
|---|---|
| PubChem CID | 118601136 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | benzyl 8-hydroxy-8-prop-2-enylcyclopentadecane-1-carboxylate |
| SMILES | C=CCC1(O)CCCCCCCC(C(=O)OCc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C26H40O3/c1-2-19-26(28)20-13-6-3-4-11-17-24(18-12-5-7-14-21-26)25(27)29-22-23-15-9-8-10-16-23/h2,8-10,15-16,24,28H,1,3-7,11-14,17-22H2 |
| InChIKey | BGRMQNUQBHUWRV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|