C24H33BrO4 — CID 118601142
(7Z,9Z)-3-bromo-5,5-bis[2-(2-methoxyethoxy)ethyl]-6-methylidene-11H-benzo[9]annulene (PubChem CID 118601142) has the molecular formula C24H33BrO4 and a molecular weight of 465.43 g/mol. Its IUPAC name is (7Z,9Z)-3-bromo-5,5-bis[2-(2-methoxyethoxy)ethyl]-6-methylidene-11H-benzo[9]annulene.
| Compound Name | (7Z,9Z)-3-bromo-5,5-bis[2-(2-methoxyethoxy)ethyl]-6-methylidene-11H-benzo[9]annulene |
|---|---|
| PubChem CID | 118601142 |
| Molecular Formula | C24H33BrO4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (7Z,9Z)-3-bromo-5,5-bis[2-(2-methoxyethoxy)ethyl]-6-methylidene-11H-benzo[9]annulene |
| SMILES | C=C1/C=C\C=C/Cc2ccc(Br)cc2C1(CCOCCOC)CCOCCOC |
| InChI | InChI=1S/C24H33BrO4/c1-20-7-5-4-6-8-21-9-10-22(25)19-23(21)24(20,11-13-28-17-15-26-2)12-14-29-18-16-27-3/h4-7,9-10,19H,1,8,11-18H2,2-3H3/b6-4-,7-5- |
| InChIKey | NJJYZEOEDGIEKA-PEPZGXQESA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|