C21H27N3O4 — CID 118601184
N-[(3'R,7R)-5,5-dimethyl-2-oxo-3'-pentylspiro[3-oxa-1-azabicyclo[4.1.0]heptane-7,2'-aziridine]-1'-yl]-2-formylbenzamide (PubChem CID 118601184) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(3'R,7R)-5,5-dimethyl-2-oxo-3'-pentylspiro[3-oxa-1-azabicyclo[4.1.0]heptane-7,2'-aziridine]-1'-yl]-2-formylbenzamide.
| Compound Name | N-[(3'R,7R)-5,5-dimethyl-2-oxo-3'-pentylspiro[3-oxa-1-azabicyclo[4.1.0]heptane-7,2'-aziridine]-1'-yl]-2-formylbenzamide |
|---|---|
| PubChem CID | 118601184 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[(3'R,7R)-5,5-dimethyl-2-oxo-3'-pentylspiro[3-oxa-1-azabicyclo[4.1.0]heptane-7,2'-aziridine]-1'-yl]-2-formylbenzamide |
| SMILES | CCCCC[C@H]1N(NC(=O)c2ccccc2C=O)[C@]12C1N2C(=O)OCC1(C)C |
| InChI | InChI=1S/C21H27N3O4/c1-4-5-6-11-16-21(18-20(2,3)13-28-19(27)23(18)21)24(16)22-17(26)15-10-8-7-9-14(15)12-25/h7-10,12,16,18H,4-6,11,13H2,1-3H3,(H,22,26)/t16-,18?,21+,23?,24?/m1/s1 |
| InChIKey | KBTKNOVPRZWOCU-YJSCYURUSA-N |
| XLogP | 2.97 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|