C27H23ClN2O5S — CID 118601600
N-[[7-chloro-2-(1-methoxyethenyl)-4-oxo-1-phenylquinolin-3-yl]methyl]-4-methylsulfonylbenzamide (PubChem CID 118601600) has the molecular formula C27H23ClN2O5S and a molecular weight of 523.01 g/mol. Its IUPAC name is N-[[7-chloro-2-(1-methoxyethenyl)-4-oxo-1-phenylquinolin-3-yl]methyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[[7-chloro-2-(1-methoxyethenyl)-4-oxo-1-phenylquinolin-3-yl]methyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 118601600 |
| Molecular Formula | C27H23ClN2O5S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | N-[[7-chloro-2-(1-methoxyethenyl)-4-oxo-1-phenylquinolin-3-yl]methyl]-4-methylsulfonylbenzamide |
| SMILES | C=C(OC)c1c(CNC(=O)c2ccc(S(C)(=O)=O)cc2)c(=O)c2ccc(Cl)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C27H23ClN2O5S/c1-17(35-2)25-23(16-29-27(32)18-9-12-21(13-10-18)36(3,33)34)26(31)22-14-11-19(28)15-24(22)30(25)20-7-5-4-6-8-20/h4-15H,1,16H2,2-3H3,(H,29,32) |
| InChIKey | LYAPNFWQOCQOSS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|