C17H24O11 — CID 118601719
[(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate (PubChem CID 118601719) has the molecular formula C17H24O11 and a molecular weight of 404.37 g/mol. Its IUPAC name is [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118601719 |
| Molecular Formula | C17H24O11 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [(5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H24O11/c1-8(18)23-6-13-15(25-10(3)20)17(27-12(5)22)16(26-11(4)21)14(28-13)7-24-9(2)19/h13-17H,6-7H2,1-5H3/t13?,14?,15-,16?,17?/m1/s1 |
| InChIKey | NSESSVVOVAHLTQ-WALXCBACSA-N |
| XLogP | -0.32 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|