About 1,3,5-trinitrosocyclohexane
1,3,5-trinitrosocyclohexane (PubChem CID 118601814) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 1,3,5-trinitrosocyclohexane.
Molecular Properties
| Compound Name | 1,3,5-trinitrosocyclohexane |
| PubChem CID | 118601814 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 1,3,5-trinitrosocyclohexane |
| SMILES | O=NC1CC(N=O)CC(N=O)C1 |
| InChI | InChI=1S/C6H9N3O3/c10-7-4-1-5(8-11)3-6(2-4)9-12/h4-6H,1-3H2 |
| InChIKey | LLCDCOURCAEIIP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3,5-trinitrosocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trinitrosocyclohexane?
The IUPAC name of 1,3,5-trinitrosocyclohexane (CID 118601814) is 1,3,5-trinitrosocyclohexane.
What is the SMILES notation for 1,3,5-trinitrosocyclohexane?
The canonical SMILES for 1,3,5-trinitrosocyclohexane is O=NC1CC(N=O)CC(N=O)C1.
What is the InChIKey of 1,3,5-trinitrosocyclohexane?
The InChIKey is LLCDCOURCAEIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c10-7-4-1-5(8-11)3-6(2-4)9-12/h4-6H,1-3H2.
What are the key properties of 1,3,5-trinitrosocyclohexane?
1,3,5-trinitrosocyclohexane has a molecular weight of 171.16 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trinitrosocyclohexane is sourced from PubChem (CID 118601814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).