About 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole
2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole (PubChem CID 118602067) has the molecular formula C23H13BrFN3
and a molecular weight of 430.28 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole |
| PubChem CID | 118602067 |
| Molecular Formula | C23H13BrFN3 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole |
| SMILES | Fc1ccc2c(c1)c1ccccc1c1nc(-c3c[nH]c4ccc(Br)cc34)[nH]c21 |
| InChI | InChI=1S/C23H13BrFN3/c24-12-5-8-20-18(9-12)19(11-26-20)23-27-21-15-4-2-1-3-14(15)17-10-13(25)6-7-16(17)22(21)28-23/h1-11,26H,(H,27,28) |
| InChIKey | JKQXCLVJWZEGCL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole?
The IUPAC name of 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole (CID 118602067) is 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole is Fc1ccc2c(c1)c1ccccc1c1nc(-c3c[nH]c4ccc(Br)cc34)[nH]c21.
What is the InChIKey of 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole?
The InChIKey is JKQXCLVJWZEGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13BrFN3/c24-12-5-8-20-18(9-12)19(11-26-20)23-27-21-15-4-2-1-3-14(15)17-10-13(25)6-7-16(17)22(21)28-23/h1-11,26H,(H,27,28).
What are the key properties of 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole?
2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole has a molecular weight of 430.28 g/mol, XLogP of 6.92, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1H-indol-3-yl)-6-fluoro-3H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 118602067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).