C16H25NO4 — CID 118602976
4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)butyl 2,2-dimethylbutanoate (PubChem CID 118602976) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)butyl 2,2-dimethylbutanoate.
| Compound Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118602976 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)butyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C16H25NO4/c1-6-16(4,5)15(20)21-10-8-7-9-17-13(18)11(2)12(3)14(17)19/h6-10H2,1-5H3 |
| InChIKey | FTEOBBRPHUCLTA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|