C6H14NO2PS — CID 11860344
(2R,4R)-N,N,4-trimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 11860344) has the molecular formula C6H14NO2PS and a molecular weight of 195.22 g/mol. Its IUPAC name is (2R,4R)-N,N,4-trimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | (2R,4R)-N,N,4-trimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 11860344 |
| Molecular Formula | C6H14NO2PS |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2R,4R)-N,N,4-trimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | C[C@@H]1CCO[P@](=S)(N(C)C)O1 |
| InChI | InChI=1S/C6H14NO2PS/c1-6-4-5-8-10(11,9-6)7(2)3/h6H,4-5H2,1-3H3/t6-,10-/m1/s1 |
| InChIKey | MDMQPPVEEDOYQR-LHLIQPBNSA-N |
| XLogP | 1.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|