About 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine
1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine (PubChem CID 118603836) has the molecular formula C13H27NS
and a molecular weight of 229.43 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine |
| PubChem CID | 118603836 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine |
| SMILES | CC(C)(C)CSC1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27NS/c1-12(2,3)10-15-11-7-8-14(9-11)13(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | OAOJIZHMZAVQLZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine?
The IUPAC name of 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine (CID 118603836) is 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine.
What is the SMILES notation for 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine?
The canonical SMILES for 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine is CC(C)(C)CSC1CCN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine?
The InChIKey is OAOJIZHMZAVQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NS/c1-12(2,3)10-15-11-7-8-14(9-11)13(4,5)6/h11H,7-10H2,1-6H3.
What are the key properties of 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine?
1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine has a molecular weight of 229.43 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(2,2-dimethylpropylsulfanyl)pyrrolidine is sourced from PubChem (CID 118603836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).