About 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate
2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate (PubChem CID 118603837) has the molecular formula C16H30O3S
and a molecular weight of 302.48 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate |
| PubChem CID | 118603837 |
| Molecular Formula | C16H30O3S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate |
| SMILES | CC(=O)C(CCCSC(C)(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C16H30O3S/c1-12(17)13(9-8-10-20-16(5,6)7)14(18)19-11-15(2,3)4/h13H,8-11H2,1-7H3 |
| InChIKey | FDZXPVIKLMBDBK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate?
The IUPAC name of 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate (CID 118603837) is 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate.
What is the SMILES notation for 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate?
The canonical SMILES for 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate is CC(=O)C(CCCSC(C)(C)C)C(=O)OCC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate?
The InChIKey is FDZXPVIKLMBDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O3S/c1-12(17)13(9-8-10-20-16(5,6)7)14(18)19-11-15(2,3)4/h13H,8-11H2,1-7H3.
What are the key properties of 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate?
2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate has a molecular weight of 302.48 g/mol, XLogP of 4.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl 2-acetyl-5-tert-butylsulfanylpentanoate is sourced from PubChem (CID 118603837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).