C8H13NO2 — CID 11860393
(1R,2S,3R,4S)-3-azaniumylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11860393) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-azaniumylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-azaniumylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11860393 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1R,2S,3R,4S)-3-azaniumylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | [NH3+][C@@H]1[C@H]2CC[C@H](C2)[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C8H13NO2/c9-7-5-2-1-4(3-5)6(7)8(10)11/h4-7H,1-3,9H2,(H,10,11)/t4-,5+,6+,7-/m1/s1 |
| InChIKey | JSYLGUSANAWARQ-JRTVQGFMSA-N |
| XLogP | -1.61 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |