About 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole
3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole (PubChem CID 118604060) has the molecular formula C36H26BrN3O2
and a molecular weight of 612.53 g/mol. Its IUPAC name is 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole |
| PubChem CID | 118604060 |
| Molecular Formula | C36H26BrN3O2 |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)c(-c2ccc(Oc3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C36H26BrN3O2/c1-23-33(31-22-26(37)16-21-32(31)38-23)36-39-34(24-12-17-29(18-13-24)41-27-8-4-2-5-9-27)35(40-36)25-14-19-30(20-15-25)42-28-10-6-3-7-11-28/h2-22,38H,1H3,(H,39,40) |
| InChIKey | MZXVMMWNQHSFLU-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole?
The IUPAC name of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole (CID 118604060) is 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole.
What is the SMILES notation for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole?
The canonical SMILES for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole is Cc1[nH]c2ccc(Br)cc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)c(-c2ccc(Oc3ccccc3)cc2)[nH]1.
What is the InChIKey of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole?
The InChIKey is MZXVMMWNQHSFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26BrN3O2/c1-23-33(31-22-26(37)16-21-32(31)38-23)36-39-34(24-12-17-29(18-13-24)41-27-8-4-2-5-9-27)35(40-36)25-14-19-30(20-15-25)42-28-10-6-3-7-11-28/h2-22,38H,1H3,(H,39,40).
What are the key properties of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole?
3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole has a molecular weight of 612.53 g/mol, XLogP of 10.55, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-5-bromo-2-methyl-1H-indole is sourced from PubChem (CID 118604060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).