C15H12ClNO3 — CID 11860421
(3aS,4S,7R,7aS)-2-(2-chlorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 11860421) has the molecular formula C15H12ClNO3 and a molecular weight of 289.72 g/mol. Its IUPAC name is (3aS,4S,7R,7aS)-2-(2-chlorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,7R,7aS)-2-(2-chlorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11860421 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (3aS,4S,7R,7aS)-2-(2-chlorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12C=C[C@H](O1)[C@H]1C(=O)N(c3ccccc3Cl)C(=O)[C@@H]12 |
| InChI | InChI=1S/C15H12ClNO3/c1-15-7-6-10(20-15)11-12(15)14(19)17(13(11)18)9-5-3-2-4-8(9)16/h2-7,10-12H,1H3/t10-,11+,12+,15+/m0/s1 |
| InChIKey | SFHXDLWVBOTKBJ-FUTJPDQTSA-N |
| XLogP | 2.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|