C10H20NS+ — CID 11860483
[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methanethiol (PubChem CID 11860483) has the molecular formula C10H20NS+ and a molecular weight of 186.34 g/mol. Its IUPAC name is [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methanethiol.
| Compound Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methanethiol |
|---|---|
| PubChem CID | 11860483 |
| Molecular Formula | C10H20NS+ |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methanethiol |
| SMILES | SC[C@H]1CCC[NH+]2CCCC[C@@H]12 |
| InChI | InChI=1S/C10H19NS/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/p+1/t9-,10+/m1/s1 |
| InChIKey | IDJFQEVIICXDDP-ZJUUUORDSA-O |
| XLogP | 0.76 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|