About (3-methylthiolan-3-yl) 2,2-dimethylbutanoate
(3-methylthiolan-3-yl) 2,2-dimethylbutanoate (PubChem CID 118605254) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is (3-methylthiolan-3-yl) 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (3-methylthiolan-3-yl) 2,2-dimethylbutanoate |
| PubChem CID | 118605254 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3-methylthiolan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCSC1 |
| InChI | InChI=1S/C11H20O2S/c1-5-10(2,3)9(12)13-11(4)6-7-14-8-11/h5-8H2,1-4H3 |
| InChIKey | YQGZFWAGGNGKBL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylthiolan-3-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylthiolan-3-yl) 2,2-dimethylbutanoate?
The IUPAC name of (3-methylthiolan-3-yl) 2,2-dimethylbutanoate (CID 118605254) is (3-methylthiolan-3-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (3-methylthiolan-3-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (3-methylthiolan-3-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1(C)CCSC1.
What is the InChIKey of (3-methylthiolan-3-yl) 2,2-dimethylbutanoate?
The InChIKey is YQGZFWAGGNGKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-5-10(2,3)9(12)13-11(4)6-7-14-8-11/h5-8H2,1-4H3.
What are the key properties of (3-methylthiolan-3-yl) 2,2-dimethylbutanoate?
(3-methylthiolan-3-yl) 2,2-dimethylbutanoate has a molecular weight of 216.35 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylthiolan-3-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 118605254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).