C10H18NO+ — CID 11860579
(2S,4aR,8aS)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-1-ium-4-one (PubChem CID 11860579) has the molecular formula C10H18NO+ and a molecular weight of 168.26 g/mol. Its IUPAC name is (2S,4aR,8aS)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-1-ium-4-one.
| Compound Name | (2S,4aR,8aS)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-1-ium-4-one |
|---|---|
| PubChem CID | 11860579 |
| Molecular Formula | C10H18NO+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (2S,4aR,8aS)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-1-ium-4-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2CCCC[C@@H]2[NH2+]1 |
| InChI | InChI=1S/C10H17NO/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h7-9,11H,2-6H2,1H3/p+1/t7-,8+,9-/m0/s1 |
| InChIKey | SEAPKWHFVCCJBB-YIZRAAEISA-O |
| XLogP | 0.47 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |