C24H36FN3O6 — CID 118606110
[(1R,3'R)-5-methoxy-3'-(3-methylbut-2-enyl)spiro[9-oxatricyclo[4.3.0.01,8]nonane-7,2'-oxirane]-4-yl] N-[4-[[2-(fluoroamino)acetyl]amino]cyclohexyl]carbamate (PubChem CID 118606110) has the molecular formula C24H36FN3O6 and a molecular weight of 481.57 g/mol. Its IUPAC name is [(1R,3'R)-5-methoxy-3'-(3-methylbut-2-enyl)spiro[9-oxatricyclo[4.3.0.01,8]nonane-7,2'-oxirane]-4-yl] N-[4-[[2-(fluoroamino)acetyl]amino]cyclohexyl]carbamate.
| Compound Name | [(1R,3'R)-5-methoxy-3'-(3-methylbut-2-enyl)spiro[9-oxatricyclo[4.3.0.01,8]nonane-7,2'-oxirane]-4-yl] N-[4-[[2-(fluoroamino)acetyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 118606110 |
| Molecular Formula | C24H36FN3O6 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(1R,3'R)-5-methoxy-3'-(3-methylbut-2-enyl)spiro[9-oxatricyclo[4.3.0.01,8]nonane-7,2'-oxirane]-4-yl] N-[4-[[2-(fluoroamino)acetyl]amino]cyclohexyl]carbamate |
| SMILES | COC1C(OC(=O)NC2CCC(NC(=O)CNF)CC2)CC[C@]23OC2C2(OC2CC=C(C)C)C13 |
| InChI | InChI=1S/C24H36FN3O6/c1-13(2)4-9-17-24(33-17)20-19(31-3)16(10-11-23(20)21(24)34-23)32-22(30)28-15-7-5-14(6-8-15)27-18(29)12-26-25/h4,14-17,19-21,26H,5-12H2,1-3H3,(H,27,29)(H,28,30)/t14?,15?,16?,17?,19?,20?,21?,23-,24?/m1/s1 |
| InChIKey | NXUODKGQCQOLQB-BHXBUQGNSA-N |
| XLogP | 2.05 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|