C24H48N4O6 — CID 118606202
(3S,6S)-3,6-bis[4-[bis[(2S)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione (PubChem CID 118606202) has the molecular formula C24H48N4O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is (3S,6S)-3,6-bis[4-[bis[(2S)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis[4-[bis[(2S)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 118606202 |
| Molecular Formula | C24H48N4O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | (3S,6S)-3,6-bis[4-[bis[(2S)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
| SMILES | C[C@H](O)CN(CCCC[C@@H]1NC(=O)[C@H](CCCCN(C[C@H](C)O)C[C@H](C)O)NC1=O)C[C@H](C)O |
| InChI | InChI=1S/C24H48N4O6/c1-17(29)13-27(14-18(2)30)11-7-5-9-21-23(33)26-22(24(34)25-21)10-6-8-12-28(15-19(3)31)16-20(4)32/h17-22,29-32H,5-16H2,1-4H3,(H,25,34)(H,26,33)/t17-,18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | NBQIIFXTOFYAHN-WLNPFYQQSA-N |
| XLogP | -0.56 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|