C21H30NO3+ — CID 11860623
(3S,3aS,5aR,9bR)-5a,9-dimethyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 11860623) has the molecular formula C21H30NO3+ and a molecular weight of 344.48 g/mol. Its IUPAC name is (3S,3aS,5aR,9bR)-5a,9-dimethyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aR,9bR)-5a,9-dimethyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 11860623 |
| Molecular Formula | C21H30NO3+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3S,3aS,5aR,9bR)-5a,9-dimethyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@@H]3OC(=O)[C@H](C[NH+]4CCC[C@H](C)C4)[C@@H]3CC[C@]2(C)C=CC1=O |
| InChI | InChI=1S/C21H29NO3/c1-13-5-4-10-22(11-13)12-16-15-6-8-21(3)9-7-17(23)14(2)18(21)19(15)25-20(16)24/h7,9,13,15-16,19H,4-6,8,10-12H2,1-3H3/p+1/t13-,15-,16+,19+,21+/m0/s1 |
| InChIKey | DOKPHLDPKYIWJE-DBPAWNNXSA-O |
| XLogP | 1.71 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |