About N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide
N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 118606288) has the molecular formula C9H14N2O4S
and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide |
| PubChem CID | 118606288 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CS(=O)(=O)CC1NC(C)=O |
| InChI | InChI=1S/C9H14N2O4S/c1-3-9(13)11-8-5-16(14,15)4-7(8)10-6(2)12/h3,7-8H,1,4-5H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | AJTPBYUYYIFETQ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide?
The IUPAC name of N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide (CID 118606288) is N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide.
What is the SMILES notation for N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide?
The canonical SMILES for N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide is C=CC(=O)NC1CS(=O)(=O)CC1NC(C)=O.
What is the InChIKey of N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide?
The InChIKey is AJTPBYUYYIFETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4S/c1-3-9(13)11-8-5-16(14,15)4-7(8)10-6(2)12/h3,7-8H,1,4-5H2,2H3,(H,10,12)(H,11,13).
What are the key properties of N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide?
N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide has a molecular weight of 246.29 g/mol, XLogP of -1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetamido-1,1-dioxothiolan-3-yl)prop-2-enamide is sourced from PubChem (CID 118606288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).