About 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one
3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one (PubChem CID 118606989) has the molecular formula C22H20F3N3O
and a molecular weight of 399.42 g/mol. Its IUPAC name is 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one.
Molecular Properties
| Compound Name | 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one |
| PubChem CID | 118606989 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one |
| SMILES | CC1(C)CC(=O)c2c([nH]c(-c3ccncc3C(F)(F)F)c2Nc2ccccc2)C1 |
| InChI | InChI=1S/C22H20F3N3O/c1-21(2)10-16-18(17(29)11-21)20(27-13-6-4-3-5-7-13)19(28-16)14-8-9-26-12-15(14)22(23,24)25/h3-9,12,27-28H,10-11H2,1-2H3 |
| InChIKey | JLONDGZWFZYHKR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one?
The IUPAC name of 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one (CID 118606989) is 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one.
What is the SMILES notation for 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one?
The canonical SMILES for 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one is CC1(C)CC(=O)c2c([nH]c(-c3ccncc3C(F)(F)F)c2Nc2ccccc2)C1.
What is the InChIKey of 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one?
The InChIKey is JLONDGZWFZYHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F3N3O/c1-21(2)10-16-18(17(29)11-21)20(27-13-6-4-3-5-7-13)19(28-16)14-8-9-26-12-15(14)22(23,24)25/h3-9,12,27-28H,10-11H2,1-2H3.
What are the key properties of 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one?
3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one has a molecular weight of 399.42 g/mol, XLogP of 5.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-6,6-dimethyl-2-[3-(trifluoromethyl)-4-pyridinyl]-5,7-dihydro-1H-indol-4-one is sourced from PubChem (CID 118606989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).