C24H23F6N3O4S — CID 118607184
3-anilino-6,6-dimethyl-2-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-4-yl]-5,7-dihydro-1H-indol-4-one;trifluoromethanesulfonate (PubChem CID 118607184) has the molecular formula C24H23F6N3O4S and a molecular weight of 563.52 g/mol. Its IUPAC name is 3-anilino-6,6-dimethyl-2-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-4-yl]-5,7-dihydro-1H-indol-4-one;trifluoromethanesulfonate.
| Compound Name | 3-anilino-6,6-dimethyl-2-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-4-yl]-5,7-dihydro-1H-indol-4-one;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118607184 |
| Molecular Formula | C24H23F6N3O4S |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 3-anilino-6,6-dimethyl-2-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-4-yl]-5,7-dihydro-1H-indol-4-one;trifluoromethanesulfonate |
| SMILES | CC1(C)CC(=O)c2c([nH]c(-c3cc[n+](CC(F)(F)F)cc3)c2Nc2ccccc2)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H22F3N3O.CHF3O3S/c1-22(2)12-17-19(18(30)13-22)21(27-16-6-4-3-5-7-16)20(28-17)15-8-10-29(11-9-15)14-23(24,25)26;2-1(3,4)8(5,6)7/h3-11H,12-14H2,1-2H3,(H,27,28,30);(H,5,6,7) |
| InChIKey | IWYJQFXJOJAXJV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|