About 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one
6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one (PubChem CID 118607314) has the molecular formula C27H25N3O2
and a molecular weight of 423.52 g/mol. Its IUPAC name is 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one |
| PubChem CID | 118607314 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one |
| SMILES | CC1(C)CC(=O)c2c([nH]c(-c3ccncc3)c2Nc2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C27H25N3O2/c1-27(2)16-22-24(23(31)17-27)26(25(30-22)18-11-13-28-14-12-18)29-19-7-6-10-21(15-19)32-20-8-4-3-5-9-20/h3-15,29-30H,16-17H2,1-2H3 |
| InChIKey | BWEYMMOANUEALY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one?
The IUPAC name of 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one (CID 118607314) is 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one.
What is the SMILES notation for 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one?
The canonical SMILES for 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one is CC1(C)CC(=O)c2c([nH]c(-c3ccncc3)c2Nc2cccc(Oc3ccccc3)c2)C1.
What is the InChIKey of 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one?
The InChIKey is BWEYMMOANUEALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N3O2/c1-27(2)16-22-24(23(31)17-27)26(25(30-22)18-11-13-28-14-12-18)29-19-7-6-10-21(15-19)32-20-8-4-3-5-9-20/h3-15,29-30H,16-17H2,1-2H3.
What are the key properties of 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one?
6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one has a molecular weight of 423.52 g/mol, XLogP of 6.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3-(3-phenoxyanilino)-2-pyridin-4-yl-5,7-dihydro-1H-indol-4-one is sourced from PubChem (CID 118607314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).