C31H48N4O2 — CID 118607414
2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine (PubChem CID 118607414) has the molecular formula C31H48N4O2 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine.
| Compound Name | 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
|---|---|
| PubChem CID | 118607414 |
| Molecular Formula | C31H48N4O2 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)cc(C3CCCCC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C31H48N4O2/c1-23(2)35-17-12-25(13-18-35)32-28-21-27(24-10-5-4-6-11-24)33-29-22-31(30(36-3)20-26(28)29)37-19-9-16-34-14-7-8-15-34/h20-25H,4-19H2,1-3H3,(H,32,33) |
| InChIKey | FQOJFAZVDGPADJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|