About 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene
4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene (PubChem CID 118607729) has the molecular formula C11H14F2N2O2S
and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene |
| PubChem CID | 118607729 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1C[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O2S/c1-15(2)18(16,17)14-11-6-8(11)7-3-4-9(12)10(13)5-7/h3-5,8,11,14H,6H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | BZSRVNKLGVTJSI-GZMMTYOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene?
The IUPAC name of 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene (CID 118607729) is 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene.
What is the SMILES notation for 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene?
The canonical SMILES for 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene is CN(C)S(=O)(=O)N[C@@H]1C[C@H]1c1ccc(F)c(F)c1.
What is the InChIKey of 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene?
The InChIKey is BZSRVNKLGVTJSI-GZMMTYOYSA-N. The full InChI is InChI=1S/C11H14F2N2O2S/c1-15(2)18(16,17)14-11-6-8(11)7-3-4-9(12)10(13)5-7/h3-5,8,11,14H,6H2,1-2H3/t8-,11+/m0/s1.
What are the key properties of 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene?
4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene has a molecular weight of 276.31 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2R)-2-(dimethylsulfamoylamino)cyclopropyl]-1,2-difluorobenzene is sourced from PubChem (CID 118607729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).