C29H31N7O3 — CID 118607833
N-[3-[[5-cyano-4-[6-[3-(dimethylamino)propoxy]-1-methylindol-3-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 118607833) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is N-[3-[[5-cyano-4-[6-[3-(dimethylamino)propoxy]-1-methylindol-3-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-cyano-4-[6-[3-(dimethylamino)propoxy]-1-methylindol-3-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118607833 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | N-[3-[[5-cyano-4-[6-[3-(dimethylamino)propoxy]-1-methylindol-3-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2ncc(C#N)c(-c3cn(C)c4cc(OCCCN(C)C)ccc34)n2)c1 |
| InChI | InChI=1S/C29H31N7O3/c1-6-27(37)32-20-8-11-26(38-5)24(14-20)33-29-31-17-19(16-30)28(34-29)23-18-36(4)25-15-21(9-10-22(23)25)39-13-7-12-35(2)3/h6,8-11,14-15,17-18H,1,7,12-13H2,2-5H3,(H,32,37)(H,31,33,34) |
| InChIKey | WLIPFWISCXKNAC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|