C10H9F8N3O2 — CID 118607933
N-methoxy-N,1-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 118607933) has the molecular formula C10H9F8N3O2 and a molecular weight of 355.19 g/mol. Its IUPAC name is N-methoxy-N,1-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-methoxy-N,1-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118607933 |
| Molecular Formula | C10H9F8N3O2 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-methoxy-N,1-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C10H9F8N3O2/c1-20-5(7(22)21(2)23-3)4(9(13,14)15)6(19-20)8(11,12)10(16,17)18/h1-3H3 |
| InChIKey | WJQGYXMMKOZVJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|